C21H20Cl2F3N3 — CID 59454662
(3S)-N-(3-chloro-4-isocyanophenyl)-N-[(2-chlorophenyl)methyl]-1-(3,3,3-trifluoropropyl)pyrrolidin-3-amine (PubChem CID 59454662) has the molecular formula C21H20Cl2F3N3 and a molecular weight of 442.31 g/mol. Its IUPAC name is (3S)-N-(3-chloro-4-isocyanophenyl)-N-[(2-chlorophenyl)methyl]-1-(3,3,3-trifluoropropyl)pyrrolidin-3-amine.
| Compound Name | (3S)-N-(3-chloro-4-isocyanophenyl)-N-[(2-chlorophenyl)methyl]-1-(3,3,3-trifluoropropyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 59454662 |
| Molecular Formula | C21H20Cl2F3N3 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | (3S)-N-(3-chloro-4-isocyanophenyl)-N-[(2-chlorophenyl)methyl]-1-(3,3,3-trifluoropropyl)pyrrolidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(N(Cc2ccccc2Cl)[C@H]2CCN(CCC(F)(F)F)C2)cc1Cl |
| InChI | InChI=1S/C21H20Cl2F3N3/c1-27-20-7-6-16(12-19(20)23)29(13-15-4-2-3-5-18(15)22)17-8-10-28(14-17)11-9-21(24,25)26/h2-7,12,17H,8-11,13-14H2/t17-/m0/s1 |
| InChIKey | JZUWPRPBUKLUIC-KRWDZBQOSA-N |
| XLogP | 6.58 |
| TPSA | 10.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|