C26H23ClF3N3 — CID 59454684
(3S)-1-benzyl-N-[(2-chlorophenyl)methyl]-N-[4-isocyano-3-(trifluoromethyl)phenyl]pyrrolidin-3-amine (PubChem CID 59454684) has the molecular formula C26H23ClF3N3 and a molecular weight of 469.94 g/mol. Its IUPAC name is (3S)-1-benzyl-N-[(2-chlorophenyl)methyl]-N-[4-isocyano-3-(trifluoromethyl)phenyl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-benzyl-N-[(2-chlorophenyl)methyl]-N-[4-isocyano-3-(trifluoromethyl)phenyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 59454684 |
| Molecular Formula | C26H23ClF3N3 |
| Molecular Weight | 469.94 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (3S)-1-benzyl-N-[(2-chlorophenyl)methyl]-N-[4-isocyano-3-(trifluoromethyl)phenyl]pyrrolidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(N(Cc2ccccc2Cl)[C@H]2CCN(Cc3ccccc3)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H23ClF3N3/c1-31-25-12-11-21(15-23(25)26(28,29)30)33(17-20-9-5-6-10-24(20)27)22-13-14-32(18-22)16-19-7-3-2-4-8-19/h2-12,15,22H,13-14,16-18H2/t22-/m0/s1 |
| InChIKey | XMCXQHCBEYSVMG-QFIPXVFZSA-N |
| XLogP | 7.19 |
| TPSA | 10.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.94 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|