C23H27ClF2N2O2 — CID 143704158
propyl 3-[2-(4-amino-3-chlorophenyl)-3-(2,3-difluorophenyl)propyl]pyrrolidine-1-carboxylate (PubChem CID 143704158) has the molecular formula C23H27ClF2N2O2 and a molecular weight of 436.93 g/mol. Its IUPAC name is propyl 3-[2-(4-amino-3-chlorophenyl)-3-(2,3-difluorophenyl)propyl]pyrrolidine-1-carboxylate.
| Compound Name | propyl 3-[2-(4-amino-3-chlorophenyl)-3-(2,3-difluorophenyl)propyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143704158 |
| Molecular Formula | C23H27ClF2N2O2 |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | propyl 3-[2-(4-amino-3-chlorophenyl)-3-(2,3-difluorophenyl)propyl]pyrrolidine-1-carboxylate |
| SMILES | CCCOC(=O)N1CCC(CC(Cc2cccc(F)c2F)c2ccc(N)c(Cl)c2)C1 |
| InChI | InChI=1S/C23H27ClF2N2O2/c1-2-10-30-23(29)28-9-8-15(14-28)11-18(16-6-7-21(27)19(24)13-16)12-17-4-3-5-20(25)22(17)26/h3-7,13,15,18H,2,8-12,14,27H2,1H3 |
| InChIKey | RFIPPCCBNNUIJZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|