C21H31ClN2O — CID 143704105
1-[(3R)-3-[1-(4-amino-3-chlorophenyl)-5-methylhex-5-en-3-yl]pyrrolidin-1-yl]-2-methylpropan-1-one (PubChem CID 143704105) has the molecular formula C21H31ClN2O and a molecular weight of 362.95 g/mol. Its IUPAC name is 1-[(3R)-3-[1-(4-amino-3-chlorophenyl)-5-methylhex-5-en-3-yl]pyrrolidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(3R)-3-[1-(4-amino-3-chlorophenyl)-5-methylhex-5-en-3-yl]pyrrolidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 143704105 |
| Molecular Formula | C21H31ClN2O |
| Molecular Weight | 362.95 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-[(3R)-3-[1-(4-amino-3-chlorophenyl)-5-methylhex-5-en-3-yl]pyrrolidin-1-yl]-2-methylpropan-1-one |
| SMILES | C=C(C)CC(CCc1ccc(N)c(Cl)c1)[C@H]1CCN(C(=O)C(C)C)C1 |
| InChI | InChI=1S/C21H31ClN2O/c1-14(2)11-17(7-5-16-6-8-20(23)19(22)12-16)18-9-10-24(13-18)21(25)15(3)4/h6,8,12,15,17-18H,1,5,7,9-11,13,23H2,2-4H3/t17?,18-/m0/s1 |
| InChIKey | AHDKLLAOAZPNTD-ZVAWYAOSSA-N |
| XLogP | 4.94 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.95 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|