C18H19ClF2 — CID 115482884
1-[2-chloro-2-(3,4-diethylphenyl)ethyl]-2,3-difluorobenzene (PubChem CID 115482884) has the molecular formula C18H19ClF2 and a molecular weight of 308.80 g/mol. Its IUPAC name is 1-[2-chloro-2-(3,4-diethylphenyl)ethyl]-2,3-difluorobenzene.
| Compound Name | 1-[2-chloro-2-(3,4-diethylphenyl)ethyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 115482884 |
| Molecular Formula | C18H19ClF2 |
| Molecular Weight | 308.80 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-[2-chloro-2-(3,4-diethylphenyl)ethyl]-2,3-difluorobenzene |
| SMILES | CCc1ccc(C(Cl)Cc2cccc(F)c2F)cc1CC |
| InChI | InChI=1S/C18H19ClF2/c1-3-12-8-9-14(10-13(12)4-2)16(19)11-15-6-5-7-17(20)18(15)21/h5-10,16H,3-4,11H2,1-2H3 |
| InChIKey | HKMHUWDCPKMCFF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.80 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|