C15H12BrClF2 — CID 113396998
1-bromo-4-[1-chloro-2-(2,3-difluorophenyl)ethyl]-2-methylbenzene (PubChem CID 113396998) has the molecular formula C15H12BrClF2 and a molecular weight of 345.61 g/mol. Its IUPAC name is 1-bromo-4-[1-chloro-2-(2,3-difluorophenyl)ethyl]-2-methylbenzene.
| Compound Name | 1-bromo-4-[1-chloro-2-(2,3-difluorophenyl)ethyl]-2-methylbenzene |
|---|---|
| PubChem CID | 113396998 |
| Molecular Formula | C15H12BrClF2 |
| Molecular Weight | 345.61 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 1-bromo-4-[1-chloro-2-(2,3-difluorophenyl)ethyl]-2-methylbenzene |
| SMILES | Cc1cc(C(Cl)Cc2cccc(F)c2F)ccc1Br |
| InChI | InChI=1S/C15H12BrClF2/c1-9-7-10(5-6-12(9)16)13(17)8-11-3-2-4-14(18)15(11)19/h2-7,13H,8H2,1H3 |
| InChIKey | OZFUSVXHWKRADF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|