C11H15F2N — CID 62601447
1-(2,3-difluorophenyl)pentan-2-amine (PubChem CID 62601447) has the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)pentan-2-amine.
| Compound Name | 1-(2,3-difluorophenyl)pentan-2-amine |
|---|---|
| PubChem CID | 62601447 |
| Molecular Formula | C11H15F2N |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 1-(2,3-difluorophenyl)pentan-2-amine |
| SMILES | CCCC(N)Cc1cccc(F)c1F |
| InChI | InChI=1S/C11H15F2N/c1-2-4-9(14)7-8-5-3-6-10(12)11(8)13/h3,5-6,9H,2,4,7,14H2,1H3 |
| InChIKey | VFVYKDVKRTUKQA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |