C15H22F2 — CID 134378783
1,2-difluoro-3-(2-propylhexyl)benzene (PubChem CID 134378783) has the molecular formula C15H22F2 and a molecular weight of 240.34 g/mol. Its IUPAC name is 1,2-difluoro-3-(2-propylhexyl)benzene.
| Compound Name | 1,2-difluoro-3-(2-propylhexyl)benzene |
|---|---|
| PubChem CID | 134378783 |
| Molecular Formula | C15H22F2 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1,2-difluoro-3-(2-propylhexyl)benzene |
| SMILES | CCCCC(CCC)Cc1cccc(F)c1F |
| InChI | InChI=1S/C15H22F2/c1-3-5-8-12(7-4-2)11-13-9-6-10-14(16)15(13)17/h6,9-10,12H,3-5,7-8,11H2,1-2H3 |
| InChIKey | WZZOBTWQDRWFCH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |