C18H28F2O — CID 115789113
1-(2,3-difluorophenyl)dodecan-2-ol (PubChem CID 115789113) has the molecular formula C18H28F2O and a molecular weight of 298.42 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)dodecan-2-ol.
| Compound Name | 1-(2,3-difluorophenyl)dodecan-2-ol |
|---|---|
| PubChem CID | 115789113 |
| Molecular Formula | C18H28F2O |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 1-(2,3-difluorophenyl)dodecan-2-ol |
| SMILES | CCCCCCCCCCC(O)Cc1cccc(F)c1F |
| InChI | InChI=1S/C18H28F2O/c1-2-3-4-5-6-7-8-9-12-16(21)14-15-11-10-13-17(19)18(15)20/h10-11,13,16,21H,2-9,12,14H2,1H3 |
| InChIKey | FVNRKWPLJUCMAN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|