C13H18Cl2O — CID 107307492
1-(2,3-dichlorophenyl)heptan-2-ol (PubChem CID 107307492) has the molecular formula C13H18Cl2O and a molecular weight of 261.19 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)heptan-2-ol.
| Compound Name | 1-(2,3-dichlorophenyl)heptan-2-ol |
|---|---|
| PubChem CID | 107307492 |
| Molecular Formula | C13H18Cl2O |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1-(2,3-dichlorophenyl)heptan-2-ol |
| SMILES | CCCCCC(O)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H18Cl2O/c1-2-3-4-7-11(16)9-10-6-5-8-12(14)13(10)15/h5-6,8,11,16H,2-4,7,9H2,1H3 |
| InChIKey | XTCYPIREOOHWEG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|