C17H18Cl2O2 — CID 107312517
1-(2,3-dichlorophenyl)-4-(4-methoxyphenyl)butan-2-ol (PubChem CID 107312517) has the molecular formula C17H18Cl2O2 and a molecular weight of 325.24 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-4-(4-methoxyphenyl)butan-2-ol.
| Compound Name | 1-(2,3-dichlorophenyl)-4-(4-methoxyphenyl)butan-2-ol |
|---|---|
| PubChem CID | 107312517 |
| Molecular Formula | C17H18Cl2O2 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-4-(4-methoxyphenyl)butan-2-ol |
| SMILES | COc1ccc(CCC(O)Cc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2O2/c1-21-15-9-6-12(7-10-15)5-8-14(20)11-13-3-2-4-16(18)17(13)19/h2-4,6-7,9-10,14,20H,5,8,11H2,1H3 |
| InChIKey | OBDGQNFONUECMR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |