C16H24ClNO — CID 78992152
1-[2-chloro-4-[cyclopropyl(3-methylbutyl)amino]phenyl]ethanol (PubChem CID 78992152) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is 1-[2-chloro-4-[cyclopropyl(3-methylbutyl)amino]phenyl]ethanol.
| Compound Name | 1-[2-chloro-4-[cyclopropyl(3-methylbutyl)amino]phenyl]ethanol |
|---|---|
| PubChem CID | 78992152 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-[2-chloro-4-[cyclopropyl(3-methylbutyl)amino]phenyl]ethanol |
| SMILES | CC(C)CCN(c1ccc(C(C)O)c(Cl)c1)C1CC1 |
| InChI | InChI=1S/C16H24ClNO/c1-11(2)8-9-18(13-4-5-13)14-6-7-15(12(3)19)16(17)10-14/h6-7,10-13,19H,4-5,8-9H2,1-3H3 |
| InChIKey | FWZTVBKLIBYADL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|