C20H22N4O2 — CID 135835697
1-cyclopentyl-5-[(2,5-dimethylphenyl)diazenyl]-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile (PubChem CID 135835697) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-cyclopentyl-5-[(2,5-dimethylphenyl)diazenyl]-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile.
| Compound Name | 1-cyclopentyl-5-[(2,5-dimethylphenyl)diazenyl]-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835697 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-cyclopentyl-5-[(2,5-dimethylphenyl)diazenyl]-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
| SMILES | Cc1ccc(C)c(/N=N/c2c(C)c(C#N)c(O)n(C3CCCC3)c2=O)c1 |
| InChI | InChI=1S/C20H22N4O2/c1-12-8-9-13(2)17(10-12)22-23-18-14(3)16(11-21)19(25)24(20(18)26)15-6-4-5-7-15/h8-10,15,25H,4-7H2,1-3H3/b23-22+ |
| InChIKey | VYXUFZJRQOUUGU-GHVJWSGMSA-N |
| XLogP | 4.88 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|