C20H21ClN4O3 — CID 135835501
5-[(3-chloro-4-methoxyphenyl)diazenyl]-1-cyclohexyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile (PubChem CID 135835501) has the molecular formula C20H21ClN4O3 and a molecular weight of 400.87 g/mol. Its IUPAC name is 5-[(3-chloro-4-methoxyphenyl)diazenyl]-1-cyclohexyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(3-chloro-4-methoxyphenyl)diazenyl]-1-cyclohexyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835501 |
| Molecular Formula | C20H21ClN4O3 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 5-[(3-chloro-4-methoxyphenyl)diazenyl]-1-cyclohexyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
| SMILES | COc1ccc(/N=N/c2c(C)c(C#N)c(O)n(C3CCCCC3)c2=O)cc1Cl |
| InChI | InChI=1S/C20H21ClN4O3/c1-12-15(11-22)19(26)25(14-6-4-3-5-7-14)20(27)18(12)24-23-13-8-9-17(28-2)16(21)10-13/h8-10,14,26H,3-7H2,1-2H3/b24-23+ |
| InChIKey | LUOWWIGZNCBMMD-WCWDXBQESA-N |
| XLogP | 5.32 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|