C18H15F3N4O5 — CID 135668964
6-hydroxy-1-(2-methoxyethyl)-4-methyl-5-[[2-nitro-4-(trifluoromethyl)phenyl]iminomethyl]-2-oxopyridine-3-carbonitrile (PubChem CID 135668964) has the molecular formula C18H15F3N4O5 and a molecular weight of 424.34 g/mol. Its IUPAC name is 6-hydroxy-1-(2-methoxyethyl)-4-methyl-5-[[2-nitro-4-(trifluoromethyl)phenyl]iminomethyl]-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-hydroxy-1-(2-methoxyethyl)-4-methyl-5-[[2-nitro-4-(trifluoromethyl)phenyl]iminomethyl]-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135668964 |
| Molecular Formula | C18H15F3N4O5 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 6-hydroxy-1-(2-methoxyethyl)-4-methyl-5-[[2-nitro-4-(trifluoromethyl)phenyl]iminomethyl]-2-oxopyridine-3-carbonitrile |
| SMILES | COCCn1c(O)c(/C=N/c2ccc(C(F)(F)F)cc2[N+](=O)[O-])c(C)c(C#N)c1=O |
| InChI | InChI=1S/C18H15F3N4O5/c1-10-12(8-22)16(26)24(5-6-30-2)17(27)13(10)9-23-14-4-3-11(18(19,20)21)7-15(14)25(28)29/h3-4,7,9,27H,5-6H2,1-2H3/b23-9+ |
| InChIKey | QOEUTWPHTMAWKW-NUGSKGIGSA-N |
| XLogP | 3.06 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|