C20H14ClN5O5 — CID 137383275
5-[[4-(4-chlorophenoxy)-2-nitrophenyl]diazenyl]-2-hydroxy-1,4-dimethyl-6-oxopyridine-3-carbonitrile (PubChem CID 137383275) has the molecular formula C20H14ClN5O5 and a molecular weight of 439.82 g/mol. Its IUPAC name is 5-[[4-(4-chlorophenoxy)-2-nitrophenyl]diazenyl]-2-hydroxy-1,4-dimethyl-6-oxopyridine-3-carbonitrile.
| Compound Name | 5-[[4-(4-chlorophenoxy)-2-nitrophenyl]diazenyl]-2-hydroxy-1,4-dimethyl-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 137383275 |
| Molecular Formula | C20H14ClN5O5 |
| Molecular Weight | 439.82 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 5-[[4-(4-chlorophenoxy)-2-nitrophenyl]diazenyl]-2-hydroxy-1,4-dimethyl-6-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(C#N)c(O)n(C)c(=O)c1/N=N/c1ccc(Oc2ccc(Cl)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H14ClN5O5/c1-11-15(10-22)19(27)25(2)20(28)18(11)24-23-16-8-7-14(9-17(16)26(29)30)31-13-5-3-12(21)4-6-13/h3-9,27H,1-2H3/b24-23+ |
| InChIKey | XPNIPUWYYJTCTQ-WCWDXBQESA-N |
| XLogP | 5.04 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.82 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|