C14H10Cl2N4O2 — CID 135790064
5-[(2,3-dichlorophenyl)diazenyl]-2-hydroxy-1,4-dimethyl-6-oxopyridine-3-carbonitrile (PubChem CID 135790064) has the molecular formula C14H10Cl2N4O2 and a molecular weight of 337.17 g/mol. Its IUPAC name is 5-[(2,3-dichlorophenyl)diazenyl]-2-hydroxy-1,4-dimethyl-6-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(2,3-dichlorophenyl)diazenyl]-2-hydroxy-1,4-dimethyl-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135790064 |
| Molecular Formula | C14H10Cl2N4O2 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 5-[(2,3-dichlorophenyl)diazenyl]-2-hydroxy-1,4-dimethyl-6-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(C#N)c(O)n(C)c(=O)c1/N=N/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H10Cl2N4O2/c1-7-8(6-17)13(21)20(2)14(22)12(7)19-18-10-5-3-4-9(15)11(10)16/h3-5,21H,1-2H3/b19-18+ |
| InChIKey | DKUYCTQBWQPVLK-VHEBQXMUSA-N |
| XLogP | 3.99 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|