C27H25Br2N3O3 — CID 137070626
1-[4-(1-adamantyl)-2-bromophenyl]-5-[(2-bromophenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 137070626) has the molecular formula C27H25Br2N3O3 and a molecular weight of 599.32 g/mol. Its IUPAC name is 1-[4-(1-adamantyl)-2-bromophenyl]-5-[(2-bromophenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-[4-(1-adamantyl)-2-bromophenyl]-5-[(2-bromophenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137070626 |
| Molecular Formula | C27H25Br2N3O3 |
| Molecular Weight | 599.32 g/mol |
| Exact Mass | 597.03 |
| IUPAC Name | 1-[4-(1-adamantyl)-2-bromophenyl]-5-[(2-bromophenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccc(C34CC5CC(CC(C5)C3)C4)cc2Br)c(O)c1/C=N/c1ccccc1Br |
| InChI | InChI=1S/C27H25Br2N3O3/c28-20-3-1-2-4-22(20)30-14-19-24(33)31-26(35)32(25(19)34)23-6-5-18(10-21(23)29)27-11-15-7-16(12-27)9-17(8-15)13-27/h1-6,10,14-17,34H,7-9,11-13H2,(H,31,33,35)/b30-14+ |
| InChIKey | WOUXOMLLGWNQMH-AMVVHIIESA-N |
| XLogP | 5.97 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.32 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|