C18H23FN5O3+ — CID 135562054
1-[2-(4-fluorophenyl)ethyl]-6-hydroxy-5-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 135562054) has the molecular formula C18H23FN5O3+ and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-6-hydroxy-5-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-6-hydroxy-5-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135562054 |
| Molecular Formula | C18H23FN5O3+ |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-6-hydroxy-5-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | C[NH+]1CCN(/N=C/c2c(O)n(CCc3ccc(F)cc3)c(=O)[nH]c2=O)CC1 |
| InChI | InChI=1S/C18H22FN5O3/c1-22-8-10-23(11-9-22)20-12-15-16(25)21-18(27)24(17(15)26)7-6-13-2-4-14(19)5-3-13/h2-5,12,26H,6-11H2,1H3,(H,21,25,27)/p+1/b20-12+ |
| InChIKey | OJMFWURODHSART-UDWIEESQSA-O |
| XLogP | -1.21 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|