C17H24N4O4 — CID 1399658
1-[2-(cyclohexen-1-yl)ethyl]-6-hydroxy-5-(morpholin-4-yliminomethyl)pyrimidine-2,4-dione (PubChem CID 1399658) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-6-hydroxy-5-(morpholin-4-yliminomethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-6-hydroxy-5-(morpholin-4-yliminomethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1399658 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-6-hydroxy-5-(morpholin-4-yliminomethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CCC2=CCCCC2)c(O)c1C=NN1CCOCC1 |
| InChI | InChI=1S/C17H24N4O4/c22-15-14(12-18-20-8-10-25-11-9-20)16(23)21(17(24)19-15)7-6-13-4-2-1-3-5-13/h4,12,23H,1-3,5-11H2,(H,19,22,24) |
| InChIKey | WLTMIAMTQWFSDP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|