C24H27N3O7 — CID 1401889
1-[2-(3,4-dimethoxyphenyl)ethyl]-5-[(3,5-dimethoxyphenyl)methyliminomethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 1401889) has the molecular formula C24H27N3O7 and a molecular weight of 469.49 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-[(3,5-dimethoxyphenyl)methyliminomethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-[(3,5-dimethoxyphenyl)methyliminomethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1401889 |
| Molecular Formula | C24H27N3O7 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-[(3,5-dimethoxyphenyl)methyliminomethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | COc1cc(C/N=C/c2c(O)n(CCc3ccc(OC)c(OC)c3)c(=O)[nH]c2=O)cc(OC)c1 |
| InChI | InChI=1S/C24H27N3O7/c1-31-17-9-16(10-18(12-17)32-2)13-25-14-19-22(28)26-24(30)27(23(19)29)8-7-15-5-6-20(33-3)21(11-15)34-4/h5-6,9-12,14,29H,7-8,13H2,1-4H3,(H,26,28,30)/b25-14+ |
| InChIKey | IAPDDFCNUPFRPG-AFUMVMLFSA-N |
| XLogP | 2.14 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|