C20H20ClN9O2S — CID 171358213
[(E)-[3-(4-chlorophenyl)-1-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)pyrazol-4-yl]methylideneamino]thiourea (PubChem CID 171358213) has the molecular formula C20H20ClN9O2S and a molecular weight of 485.96 g/mol. Its IUPAC name is [(E)-[3-(4-chlorophenyl)-1-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)pyrazol-4-yl]methylideneamino]thiourea.
| Compound Name | [(E)-[3-(4-chlorophenyl)-1-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)pyrazol-4-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 171358213 |
| Molecular Formula | C20H20ClN9O2S |
| Molecular Weight | 485.96 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | [(E)-[3-(4-chlorophenyl)-1-(7-ethyl-1,3-dimethyl-2,6-dioxopurin-8-yl)pyrazol-4-yl]methylideneamino]thiourea |
| SMILES | CCn1c(-n2cc(/C=N/NC(N)=S)c(-c3ccc(Cl)cc3)n2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C20H20ClN9O2S/c1-4-29-15-16(27(2)20(32)28(3)17(15)31)24-19(29)30-10-12(9-23-25-18(22)33)14(26-30)11-5-7-13(21)8-6-11/h5-10H,4H2,1-3H3,(H3,22,25,33)/b23-9+ |
| InChIKey | DRFOKIJYYXHXCN-NUGSKGIGSA-N |
| XLogP | 1.13 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.96 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|