C19H19BrN4O3 — CID 66753452
8-bromo-3-methyl-7-(2-methylbut-2-enyl)-1-phenacylpurine-2,6-dione (PubChem CID 66753452) has the molecular formula C19H19BrN4O3 and a molecular weight of 431.29 g/mol. Its IUPAC name is 8-bromo-3-methyl-7-(2-methylbut-2-enyl)-1-phenacylpurine-2,6-dione.
| Compound Name | 8-bromo-3-methyl-7-(2-methylbut-2-enyl)-1-phenacylpurine-2,6-dione |
|---|---|
| PubChem CID | 66753452 |
| Molecular Formula | C19H19BrN4O3 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 8-bromo-3-methyl-7-(2-methylbut-2-enyl)-1-phenacylpurine-2,6-dione |
| SMILES | CC=C(C)Cn1c(Br)nc2c1c(=O)n(CC(=O)c1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C19H19BrN4O3/c1-4-12(2)10-23-15-16(21-18(23)20)22(3)19(27)24(17(15)26)11-14(25)13-8-6-5-7-9-13/h4-9H,10-11H2,1-3H3 |
| InChIKey | ZLYNWZDJHMSACM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|