C28H29N5O4 — CID 11685887
8-[[(1R,2S)-2-amino-2,3-dihydro-1H-inden-1-yl]oxy]-3-methyl-7-(3-methylbut-2-enyl)-1-phenacylpurine-2,6-dione (PubChem CID 11685887) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is 8-[[(1R,2S)-2-amino-2,3-dihydro-1H-inden-1-yl]oxy]-3-methyl-7-(3-methylbut-2-enyl)-1-phenacylpurine-2,6-dione.
| Compound Name | 8-[[(1R,2S)-2-amino-2,3-dihydro-1H-inden-1-yl]oxy]-3-methyl-7-(3-methylbut-2-enyl)-1-phenacylpurine-2,6-dione |
|---|---|
| PubChem CID | 11685887 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 8-[[(1R,2S)-2-amino-2,3-dihydro-1H-inden-1-yl]oxy]-3-methyl-7-(3-methylbut-2-enyl)-1-phenacylpurine-2,6-dione |
| SMILES | CC(C)=CCn1c(O[C@@H]2c3ccccc3C[C@@H]2N)nc2c1c(=O)n(CC(=O)c1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C28H29N5O4/c1-17(2)13-14-32-23-25(30-27(32)37-24-20-12-8-7-11-19(20)15-21(24)29)31(3)28(36)33(26(23)35)16-22(34)18-9-5-4-6-10-18/h4-13,21,24H,14-16,29H2,1-3H3/t21-,24+/m0/s1 |
| InChIKey | ABNFBBYFAOAGKP-XUZZJYLKSA-N |
| XLogP | 2.75 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|