C26H34ClN5O4 — CID 66962908
8-[2-(aminomethyl)cyclohexyl]oxy-3-methyl-7-(3-methylbut-2-enyl)-1-phenacylpurine-2,6-dione;hydrochloride (PubChem CID 66962908) has the molecular formula C26H34ClN5O4 and a molecular weight of 516.04 g/mol. Its IUPAC name is 8-[2-(aminomethyl)cyclohexyl]oxy-3-methyl-7-(3-methylbut-2-enyl)-1-phenacylpurine-2,6-dione;hydrochloride.
| Compound Name | 8-[2-(aminomethyl)cyclohexyl]oxy-3-methyl-7-(3-methylbut-2-enyl)-1-phenacylpurine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 66962908 |
| Molecular Formula | C26H34ClN5O4 |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 8-[2-(aminomethyl)cyclohexyl]oxy-3-methyl-7-(3-methylbut-2-enyl)-1-phenacylpurine-2,6-dione;hydrochloride |
| SMILES | CC(C)=CCn1c(OC2CCCCC2CN)nc2c1c(=O)n(CC(=O)c1ccccc1)c(=O)n2C.Cl |
| InChI | InChI=1S/C26H33N5O4.ClH/c1-17(2)13-14-30-22-23(28-25(30)35-21-12-8-7-11-19(21)15-27)29(3)26(34)31(24(22)33)16-20(32)18-9-5-4-6-10-18;/h4-6,9-10,13,19,21H,7-8,11-12,14-16,27H2,1-3H3;1H |
| InChIKey | XNRGYLXBBGIAIB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|