C22H25N5O3S — CID 69451868
8-(1-amino-2-methylpropan-2-yl)sulfanyl-7-but-2-ynyl-3-methyl-1-phenacylpurine-2,6-dione (PubChem CID 69451868) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is 8-(1-amino-2-methylpropan-2-yl)sulfanyl-7-but-2-ynyl-3-methyl-1-phenacylpurine-2,6-dione.
| Compound Name | 8-(1-amino-2-methylpropan-2-yl)sulfanyl-7-but-2-ynyl-3-methyl-1-phenacylpurine-2,6-dione |
|---|---|
| PubChem CID | 69451868 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 8-(1-amino-2-methylpropan-2-yl)sulfanyl-7-but-2-ynyl-3-methyl-1-phenacylpurine-2,6-dione |
| SMILES | CC#CCn1c(SC(C)(C)CN)nc2c1c(=O)n(CC(=O)c1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C22H25N5O3S/c1-5-6-12-26-17-18(24-20(26)31-22(2,3)14-23)25(4)21(30)27(19(17)29)13-16(28)15-10-8-7-9-11-15/h7-11H,12-14,23H2,1-4H3 |
| InChIKey | XLWNEPWEHKHGNW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|