C20H18ClN7O2 — CID 1416639
1-[(2-chlorophenyl)methyl]-3,7-dimethyl-8-[2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione (PubChem CID 1416639) has the molecular formula C20H18ClN7O2 and a molecular weight of 423.86 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3,7-dimethyl-8-[2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3,7-dimethyl-8-[2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 1416639 |
| Molecular Formula | C20H18ClN7O2 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3,7-dimethyl-8-[2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione |
| SMILES | Cn1c(NN=Cc2cccnc2)nc2c1c(=O)n(Cc1ccccc1Cl)c(=O)n2C |
| InChI | InChI=1S/C20H18ClN7O2/c1-26-16-17(24-19(26)25-23-11-13-6-5-9-22-10-13)27(2)20(30)28(18(16)29)12-14-7-3-4-8-15(14)21/h3-11H,12H2,1-2H3,(H,24,25) |
| InChIKey | BIBADKHQKJHXHB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|