C26H21ClN6O5 — CID 1409721
[4-[[[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 1409721) has the molecular formula C26H21ClN6O5 and a molecular weight of 532.94 g/mol. Its IUPAC name is [4-[[[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[[[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 1409721 |
| Molecular Formula | C26H21ClN6O5 |
| Molecular Weight | 532.94 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | [4-[[[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | Cn1c(=O)c2c(nc(NN=Cc3ccc(OC(=O)c4ccco4)cc3)n2Cc2ccccc2Cl)n(C)c1=O |
| InChI | InChI=1S/C26H21ClN6O5/c1-31-22-21(23(34)32(2)26(31)36)33(15-17-6-3-4-7-19(17)27)25(29-22)30-28-14-16-9-11-18(12-10-16)38-24(35)20-8-5-13-37-20/h3-14H,15H2,1-2H3,(H,29,30) |
| InChIKey | IDUHPEJOJCAKLB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.94 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|