C29H28N6O4 — CID 171363084
7-benzyl-8-[(2E)-2-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 171363084) has the molecular formula C29H28N6O4 and a molecular weight of 524.58 g/mol. Its IUPAC name is 7-benzyl-8-[(2E)-2-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-[(2E)-2-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 171363084 |
| Molecular Formula | C29H28N6O4 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 7-benzyl-8-[(2E)-2-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | COc1cc(/C=N/Nc2nc3c(c(=O)n(C)c(=O)n3C)n2Cc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C29H28N6O4/c1-33-26-25(27(36)34(2)29(33)37)35(18-20-10-6-4-7-11-20)28(31-26)32-30-17-22-14-15-23(24(16-22)38-3)39-19-21-12-8-5-9-13-21/h4-17H,18-19H2,1-3H3,(H,31,32)/b30-17+ |
| InChIKey | ZFMGMPZEVCTWCR-OCSSWDANSA-N |
| XLogP | 3.52 |
| TPSA | 104.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|