C18H22N6O4 — CID 3783555
8-[2-[(4-ethoxy-3-methoxyphenyl)methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 3783555) has the molecular formula C18H22N6O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 8-[2-[(4-ethoxy-3-methoxyphenyl)methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[2-[(4-ethoxy-3-methoxyphenyl)methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 3783555 |
| Molecular Formula | C18H22N6O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 8-[2-[(4-ethoxy-3-methoxyphenyl)methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | CCOc1ccc(C=NNc2nc3c(c(=O)n(C)c(=O)n3C)n2C)cc1OC |
| InChI | InChI=1S/C18H22N6O4/c1-6-28-12-8-7-11(9-13(12)27-5)10-19-21-17-20-15-14(22(17)2)16(25)24(4)18(26)23(15)3/h7-10H,6H2,1-5H3,(H,20,21) |
| InChIKey | VNUDUHUNIMKPBM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 104.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|