C21H22N8O5 — CID 135485051
8-[(2E)-2-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 135485051) has the molecular formula C21H22N8O5 and a molecular weight of 466.46 g/mol. Its IUPAC name is 8-[(2E)-2-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[(2E)-2-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 135485051 |
| Molecular Formula | C21H22N8O5 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 8-[(2E)-2-[[1-(3,4-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/Nc3nc4c(c(=O)n(C)c(=O)n4C)n3C)c(=O)[nH]c2=O)cc1C |
| InChI | InChI=1S/C21H22N8O5/c1-10-6-7-12(8-11(10)2)29-17(31)13(16(30)24-20(29)33)9-22-25-19-23-15-14(26(19)3)18(32)28(5)21(34)27(15)4/h6-9,31H,1-5H3,(H,23,25)(H,24,30,33)/b22-9+ |
| InChIKey | CSBRIHWUQQXGHN-LSFURLLWSA-N |
| XLogP | -0.42 |
| TPSA | 161.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|