C19H24N4O3 — CID 135715871
1-cycloheptyl-6-hydroxy-5-[(E)-[(2-methylphenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione (PubChem CID 135715871) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-cycloheptyl-6-hydroxy-5-[(E)-[(2-methylphenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-cycloheptyl-6-hydroxy-5-[(E)-[(2-methylphenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135715871 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-cycloheptyl-6-hydroxy-5-[(E)-[(2-methylphenyl)hydrazinylidene]methyl]pyrimidine-2,4-dione |
| SMILES | Cc1ccccc1N/N=C/c1c(O)n(C2CCCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H24N4O3/c1-13-8-6-7-11-16(13)22-20-12-15-17(24)21-19(26)23(18(15)25)14-9-4-2-3-5-10-14/h6-8,11-12,14,22,25H,2-5,9-10H2,1H3,(H,21,24,26)/b20-12+ |
| InChIKey | ZWJMNYYVHRBTIL-UDWIEESQSA-N |
| XLogP | 2.89 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|