C22H16BrN3O2 — CID 135517136
5-bromo-N-[(E)-(4-hydroxyphenyl)methylideneamino]-3-phenyl-1H-indole-2-carboxamide (PubChem CID 135517136) has the molecular formula C22H16BrN3O2 and a molecular weight of 434.29 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(4-hydroxyphenyl)methylideneamino]-3-phenyl-1H-indole-2-carboxamide.
| Compound Name | 5-bromo-N-[(E)-(4-hydroxyphenyl)methylideneamino]-3-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135517136 |
| Molecular Formula | C22H16BrN3O2 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 5-bromo-N-[(E)-(4-hydroxyphenyl)methylideneamino]-3-phenyl-1H-indole-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(O)cc1)c1[nH]c2ccc(Br)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C22H16BrN3O2/c23-16-8-11-19-18(12-16)20(15-4-2-1-3-5-15)21(25-19)22(28)26-24-13-14-6-9-17(27)10-7-14/h1-13,25,27H,(H,26,28)/b24-13+ |
| InChIKey | GFNVXYLNGIDIKC-ZMOGYAJESA-N |
| XLogP | 5.07 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|