C27H18BrN3O3S — CID 175683989
3-[5-[(E)-[(5-bromo-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]thiophen-2-yl]benzoic acid (PubChem CID 175683989) has the molecular formula C27H18BrN3O3S and a molecular weight of 544.43 g/mol. Its IUPAC name is 3-[5-[(E)-[(5-bromo-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]thiophen-2-yl]benzoic acid.
| Compound Name | 3-[5-[(E)-[(5-bromo-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]thiophen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 175683989 |
| Molecular Formula | C27H18BrN3O3S |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 543.03 |
| IUPAC Name | 3-[5-[(E)-[(5-bromo-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]thiophen-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2ccc(/C=N/NC(=O)c3[nH]c4ccc(Br)cc4c3-c3ccccc3)s2)c1 |
| InChI | InChI=1S/C27H18BrN3O3S/c28-19-9-11-22-21(14-19)24(16-5-2-1-3-6-16)25(30-22)26(32)31-29-15-20-10-12-23(35-20)17-7-4-8-18(13-17)27(33)34/h1-15,30H,(H,31,32)(H,33,34)/b29-15+ |
| InChIKey | BBNUXMXYDFNVRS-WKULSOCRSA-N |
| XLogP | 6.79 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|