C23H15BrN4O — CID 10203805
5-bromo-N-[(E)-(4-cyanophenyl)methylideneamino]-3-phenyl-1H-indole-2-carboxamide (PubChem CID 10203805) has the molecular formula C23H15BrN4O and a molecular weight of 443.30 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(4-cyanophenyl)methylideneamino]-3-phenyl-1H-indole-2-carboxamide.
| Compound Name | 5-bromo-N-[(E)-(4-cyanophenyl)methylideneamino]-3-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 10203805 |
| Molecular Formula | C23H15BrN4O |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 5-bromo-N-[(E)-(4-cyanophenyl)methylideneamino]-3-phenyl-1H-indole-2-carboxamide |
| SMILES | N#Cc1ccc(/C=N/NC(=O)c2[nH]c3ccc(Br)cc3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H15BrN4O/c24-18-10-11-20-19(12-18)21(17-4-2-1-3-5-17)22(27-20)23(29)28-26-14-16-8-6-15(13-25)7-9-16/h1-12,14,27H,(H,28,29)/b26-14+ |
| InChIKey | GRIGXJCVYPSHEO-VULFUBBASA-N |
| XLogP | 5.23 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|