C25H18N4O5 — CID 14983887
4-[[2-[[(E)-(4-carboxyphenyl)methylideneamino]carbamoyl]-1H-indol-3-yl]iminomethyl]benzoic acid (PubChem CID 14983887) has the molecular formula C25H18N4O5 and a molecular weight of 454.44 g/mol. Its IUPAC name is 4-[[2-[[(E)-(4-carboxyphenyl)methylideneamino]carbamoyl]-1H-indol-3-yl]iminomethyl]benzoic acid.
| Compound Name | 4-[[2-[[(E)-(4-carboxyphenyl)methylideneamino]carbamoyl]-1H-indol-3-yl]iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 14983887 |
| Molecular Formula | C25H18N4O5 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 4-[[2-[[(E)-(4-carboxyphenyl)methylideneamino]carbamoyl]-1H-indol-3-yl]iminomethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=N/NC(=O)c2[nH]c3ccccc3c2/N=C/c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H18N4O5/c30-23(29-27-14-16-7-11-18(12-8-16)25(33)34)22-21(19-3-1-2-4-20(19)28-22)26-13-15-5-9-17(10-6-15)24(31)32/h1-14,28H,(H,29,30)(H,31,32)(H,33,34)/b26-13+,27-14+ |
| InChIKey | LWPRNMQAAVZNJG-BMNRKXRESA-N |
| XLogP | 4.08 |
| TPSA | 144.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|