C28H20Cl2N4O2 — CID 22888326
N-[(E)-(4-acetylphenyl)methylideneamino]-9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxamide (PubChem CID 22888326) has the molecular formula C28H20Cl2N4O2 and a molecular weight of 515.40 g/mol. Its IUPAC name is N-[(E)-(4-acetylphenyl)methylideneamino]-9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | N-[(E)-(4-acetylphenyl)methylideneamino]-9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 22888326 |
| Molecular Formula | C28H20Cl2N4O2 |
| Molecular Weight | 515.40 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | N-[(E)-(4-acetylphenyl)methylideneamino]-9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxamide |
| SMILES | CC(=O)c1ccc(/C=N/NC(=O)c2cc3c4ccccc4n(Cc4cc(Cl)ccc4Cl)c3cn2)cc1 |
| InChI | InChI=1S/C28H20Cl2N4O2/c1-17(35)19-8-6-18(7-9-19)14-32-33-28(36)25-13-23-22-4-2-3-5-26(22)34(27(23)15-31-25)16-20-12-21(29)10-11-24(20)30/h2-15H,16H2,1H3,(H,33,36)/b32-14+ |
| InChIKey | HQAGALQCTVJFPR-HIWRWHBISA-N |
| XLogP | 6.51 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.40 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|