C20H25NO6 — CID 59409118
1-O-tert-butyl 2-O-ethyl 3-(2-ethoxy-2-oxoethyl)indole-1,2-dicarboxylate (PubChem CID 59409118) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl 3-(2-ethoxy-2-oxoethyl)indole-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl 3-(2-ethoxy-2-oxoethyl)indole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59409118 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl 3-(2-ethoxy-2-oxoethyl)indole-1,2-dicarboxylate |
| SMILES | CCOC(=O)Cc1c(C(=O)OCC)n(C(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C20H25NO6/c1-6-25-16(22)12-14-13-10-8-9-11-15(13)21(17(14)18(23)26-7-2)19(24)27-20(3,4)5/h8-11H,6-7,12H2,1-5H3 |
| InChIKey | LZOKKBHMGIDIST-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|