C28H30Cl2N2O7 — CID 67705869
1-O-tert-butyl 2-O-ethyl 5-amino-4,6-dichloro-3-[2-oxo-2-(4-oxo-4-phenylbutoxy)ethyl]indole-1,2-dicarboxylate (PubChem CID 67705869) has the molecular formula C28H30Cl2N2O7 and a molecular weight of 577.46 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl 5-amino-4,6-dichloro-3-[2-oxo-2-(4-oxo-4-phenylbutoxy)ethyl]indole-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl 5-amino-4,6-dichloro-3-[2-oxo-2-(4-oxo-4-phenylbutoxy)ethyl]indole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67705869 |
| Molecular Formula | C28H30Cl2N2O7 |
| Molecular Weight | 577.46 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl 5-amino-4,6-dichloro-3-[2-oxo-2-(4-oxo-4-phenylbutoxy)ethyl]indole-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1c(CC(=O)OCCCC(=O)c2ccccc2)c2c(Cl)c(N)c(Cl)cc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H30Cl2N2O7/c1-5-37-26(35)25-17(14-21(34)38-13-9-12-20(33)16-10-7-6-8-11-16)22-19(15-18(29)24(31)23(22)30)32(25)27(36)39-28(2,3)4/h6-8,10-11,15H,5,9,12-14,31H2,1-4H3 |
| InChIKey | FCFXAKPQBRTBQA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.46 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|