C18H22N2O6 — CID 171805338
1-O-tert-butyl 2-O-ethyl 5-O-methyl 3-aminoindole-1,2,5-tricarboxylate (PubChem CID 171805338) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl 5-O-methyl 3-aminoindole-1,2,5-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl 5-O-methyl 3-aminoindole-1,2,5-tricarboxylate |
|---|---|
| PubChem CID | 171805338 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl 5-O-methyl 3-aminoindole-1,2,5-tricarboxylate |
| SMILES | CCOC(=O)c1c(N)c2cc(C(=O)OC)ccc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H22N2O6/c1-6-25-16(22)14-13(19)11-9-10(15(21)24-5)7-8-12(11)20(14)17(23)26-18(2,3)4/h7-9H,6,19H2,1-5H3 |
| InChIKey | CXJYKERUFQGTPW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|