C15H18FN3O5 — CID 138644315
1-O-tert-butyl 5-O-methyl 3-(fluorooxymethylamino)indazole-1,5-dicarboxylate (PubChem CID 138644315) has the molecular formula C15H18FN3O5 and a molecular weight of 339.32 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl 3-(fluorooxymethylamino)indazole-1,5-dicarboxylate.
| Compound Name | 1-O-tert-butyl 5-O-methyl 3-(fluorooxymethylamino)indazole-1,5-dicarboxylate |
|---|---|
| PubChem CID | 138644315 |
| Molecular Formula | C15H18FN3O5 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl 3-(fluorooxymethylamino)indazole-1,5-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c(NCOF)nn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H18FN3O5/c1-15(2,3)24-14(21)19-11-6-5-9(13(20)22-4)7-10(11)12(18-19)17-8-23-16/h5-7H,8H2,1-4H3,(H,17,18) |
| InChIKey | RYVHQLLEMUNXPJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|