C24H25BrN2O4 — CID 172880606
tert-butyl 3-bromo-2-[phenylmethoxycarbonyl(prop-2-enyl)amino]indole-1-carboxylate (PubChem CID 172880606) has the molecular formula C24H25BrN2O4 and a molecular weight of 485.38 g/mol. Its IUPAC name is tert-butyl 3-bromo-2-[phenylmethoxycarbonyl(prop-2-enyl)amino]indole-1-carboxylate.
| Compound Name | tert-butyl 3-bromo-2-[phenylmethoxycarbonyl(prop-2-enyl)amino]indole-1-carboxylate |
|---|---|
| PubChem CID | 172880606 |
| Molecular Formula | C24H25BrN2O4 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | tert-butyl 3-bromo-2-[phenylmethoxycarbonyl(prop-2-enyl)amino]indole-1-carboxylate |
| SMILES | C=CCN(C(=O)OCc1ccccc1)c1c(Br)c2ccccc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H25BrN2O4/c1-5-15-26(22(28)30-16-17-11-7-6-8-12-17)21-20(25)18-13-9-10-14-19(18)27(21)23(29)31-24(2,3)4/h5-14H,1,15-16H2,2-4H3 |
| InChIKey | BDMMPROJTHMYGM-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|