C25H29NO7 — CID 102142993
9-O-tert-butyl 3-O-methyl 4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyloxy]carbazole-3,9-dicarboxylate (PubChem CID 102142993) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is 9-O-tert-butyl 3-O-methyl 4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyloxy]carbazole-3,9-dicarboxylate.
| Compound Name | 9-O-tert-butyl 3-O-methyl 4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyloxy]carbazole-3,9-dicarboxylate |
|---|---|
| PubChem CID | 102142993 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 9-O-tert-butyl 3-O-methyl 4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyloxy]carbazole-3,9-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)OC(C)(C)C)c2c(c1C)c1ccccc1n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H29NO7/c1-14-16(21(27)30-8)13-18(31-23(29)33-25(5,6)7)20-19(14)15-11-9-10-12-17(15)26(20)22(28)32-24(2,3)4/h9-13H,1-8H3 |
| InChIKey | LEEMNTCXFLZVLC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|