C24H19N3O3 — CID 137393235
3-ethyl-13-(2-hydroxyethyl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 137393235) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-ethyl-13-(2-hydroxyethyl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 3-ethyl-13-(2-hydroxyethyl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 137393235 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 3-ethyl-13-(2-hydroxyethyl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | CCn1c2ccccc2c2c3c(c4c5ccccc5[nH]c4c21)C(=O)N(CCO)C3=O |
| InChI | InChI=1S/C24H19N3O3/c1-2-26-16-10-6-4-8-14(16)18-20-19(23(29)27(11-12-28)24(20)30)17-13-7-3-5-9-15(13)25-21(17)22(18)26/h3-10,25,28H,2,11-12H2,1H3 |
| InChIKey | QZMYUQAIVAXXID-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|