C24H17N3O2 — CID 20765479
14-methyl-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5,7,9,11,16,18,20,22(26)-nonaene-13,15-dione (PubChem CID 20765479) has the molecular formula C24H17N3O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 14-methyl-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5,7,9,11,16,18,20,22(26)-nonaene-13,15-dione.
| Compound Name | 14-methyl-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5,7,9,11,16,18,20,22(26)-nonaene-13,15-dione |
|---|---|
| PubChem CID | 20765479 |
| Molecular Formula | C24H17N3O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 14-methyl-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5,7,9,11,16,18,20,22(26)-nonaene-13,15-dione |
| SMILES | CN1C(=O)c2c(c3c4cccc5c4n(c3c3[nH]c4ccccc4c23)CCC5)C1=O |
| InChI | InChI=1S/C24H17N3O2/c1-26-23(28)18-16-13-8-2-3-10-15(13)25-20(16)22-17(19(18)24(26)29)14-9-4-6-12-7-5-11-27(22)21(12)14/h2-4,6,8-10,25H,5,7,11H2,1H3 |
| InChIKey | RKMYNPGDXVMVDN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|