C29H28IN5O3 — CID 142070217
formamide;24-(pyrrolidin-1-ylmethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5,7,9,11,16,18,20,22(26)-nonaene-13,15-dione;hydroiodide (PubChem CID 142070217) has the molecular formula C29H28IN5O3 and a molecular weight of 621.48 g/mol. Its IUPAC name is formamide;24-(pyrrolidin-1-ylmethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5,7,9,11,16,18,20,22(26)-nonaene-13,15-dione;hydroiodide.
| Compound Name | formamide;24-(pyrrolidin-1-ylmethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5,7,9,11,16,18,20,22(26)-nonaene-13,15-dione;hydroiodide |
|---|---|
| PubChem CID | 142070217 |
| Molecular Formula | C29H28IN5O3 |
| Molecular Weight | 621.48 g/mol |
| Exact Mass | 621.12 |
| IUPAC Name | formamide;24-(pyrrolidin-1-ylmethyl)-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5,7,9,11,16,18,20,22(26)-nonaene-13,15-dione;hydroiodide |
| SMILES | I.NC=O.O=C1NC(=O)c2c1c1c3ccccc3[nH]c1c1c2c2cccc3c2n1CC(CN1CCCC1)C3 |
| InChI | InChI=1S/C28H24N4O2.CH3NO.HI/c33-27-22-20-17-7-1-2-9-19(17)29-24(20)26-21(23(22)28(34)30-27)18-8-5-6-16-12-15(14-32(26)25(16)18)13-31-10-3-4-11-31;2-1-3;/h1-2,5-9,15,29H,3-4,10-14H2,(H,30,33,34);1H,(H2,2,3);1H |
| InChIKey | DJJVXRWFVKCLTL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|