C27H23N3O2 — CID 20765451
6-butyl-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5,7,9,11,16,18,20,22(26)-nonaene-13,15-dione (PubChem CID 20765451) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 6-butyl-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5,7,9,11,16,18,20,22(26)-nonaene-13,15-dione.
| Compound Name | 6-butyl-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5,7,9,11,16,18,20,22(26)-nonaene-13,15-dione |
|---|---|
| PubChem CID | 20765451 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 6-butyl-1,4,14-triazaheptacyclo[16.7.1.02,17.03,11.05,10.012,16.022,26]hexacosa-2,5,7,9,11,16,18,20,22(26)-nonaene-13,15-dione |
| SMILES | CCCCc1cccc2c1[nH]c1c2c2c(c3c4cccc5c4n(c13)CCC5)C(=O)NC2=O |
| InChI | InChI=1S/C27H23N3O2/c1-2-3-7-14-8-4-11-16-18-20-21(27(32)29-26(20)31)19-17-12-5-9-15-10-6-13-30(24(15)17)25(19)23(18)28-22(14)16/h4-5,8-9,11-12,28H,2-3,6-7,10,13H2,1H3,(H,29,31,32) |
| InChIKey | ASQZQBMOBZIJDI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|