C24H18N4O2 — CID 20765476
4-methyl-1,4,14,24-tetrazaheptacyclo[16.8.1.02,17.03,11.05,10.012,16.022,27]heptacosa-2,5,7,9,11,16,18,20,22(27)-nonaene-13,15-dione (PubChem CID 20765476) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-methyl-1,4,14,24-tetrazaheptacyclo[16.8.1.02,17.03,11.05,10.012,16.022,27]heptacosa-2,5,7,9,11,16,18,20,22(27)-nonaene-13,15-dione.
| Compound Name | 4-methyl-1,4,14,24-tetrazaheptacyclo[16.8.1.02,17.03,11.05,10.012,16.022,27]heptacosa-2,5,7,9,11,16,18,20,22(27)-nonaene-13,15-dione |
|---|---|
| PubChem CID | 20765476 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 4-methyl-1,4,14,24-tetrazaheptacyclo[16.8.1.02,17.03,11.05,10.012,16.022,27]heptacosa-2,5,7,9,11,16,18,20,22(27)-nonaene-13,15-dione |
| SMILES | Cn1c2ccccc2c2c3c(c4c5cccc6c5n(c4c21)CCNC6)C(=O)NC3=O |
| InChI | InChI=1S/C24H18N4O2/c1-27-15-8-3-2-6-13(15)16-18-19(24(30)26-23(18)29)17-14-7-4-5-12-11-25-9-10-28(20(12)14)22(17)21(16)27/h2-8,25H,9-11H2,1H3,(H,26,29,30) |
| InChIKey | SCVVQGUFAATPHI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|