C24H19N5O4 — CID 13006221
tert-butyl 13-methyl-12,14-dioxo-3,5,13,21,23-pentazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-3-carboxylate (PubChem CID 13006221) has the molecular formula C24H19N5O4 and a molecular weight of 441.45 g/mol. Its IUPAC name is tert-butyl 13-methyl-12,14-dioxo-3,5,13,21,23-pentazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-3-carboxylate.
| Compound Name | tert-butyl 13-methyl-12,14-dioxo-3,5,13,21,23-pentazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-3-carboxylate |
|---|---|
| PubChem CID | 13006221 |
| Molecular Formula | C24H19N5O4 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | tert-butyl 13-methyl-12,14-dioxo-3,5,13,21,23-pentazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-3-carboxylate |
| SMILES | CN1C(=O)c2c(c3c4cccnc4n(C(=O)OC(C)(C)C)c3c3[nH]c4ncccc4c23)C1=O |
| InChI | InChI=1S/C24H19N5O4/c1-24(2,3)33-23(32)29-18-14(12-8-6-10-26-20(12)29)16-15(21(30)28(4)22(16)31)13-11-7-5-9-25-19(11)27-17(13)18/h5-10H,1-4H3,(H,25,27) |
| InChIKey | WNZNERJCUYXGPU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|