C13H15IN2O2 — CID 11132071
tert-butyl 3-(iodomethyl)pyrrolo[2,3-b]pyridine-1-carboxylate (PubChem CID 11132071) has the molecular formula C13H15IN2O2 and a molecular weight of 358.18 g/mol. Its IUPAC name is tert-butyl 3-(iodomethyl)pyrrolo[2,3-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 3-(iodomethyl)pyrrolo[2,3-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 11132071 |
| Molecular Formula | C13H15IN2O2 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | tert-butyl 3-(iodomethyl)pyrrolo[2,3-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(CI)c2cccnc21 |
| InChI | InChI=1S/C13H15IN2O2/c1-13(2,3)18-12(17)16-8-9(7-14)10-5-4-6-15-11(10)16/h4-6,8H,7H2,1-3H3 |
| InChIKey | DKFYBUKLRDVWKY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|